C17H22N4O4S2 — CID 53142623
N-[(2-methoxyphenyl)methyl]-1-methyl-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide (PubChem CID 53142623) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-1-methyl-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-1-methyl-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53142623 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-1-methyl-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cn(C)nc1S(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C17H22N4O4S2/c1-20-12-14(16(22)18-11-13-5-3-4-6-15(13)25-2)17(19-20)27(23,24)21-7-9-26-10-8-21/h3-6,12H,7-11H2,1-2H3,(H,18,22) |
| InChIKey | DLBBASQFTCJJKO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |