C24H52O2Si — CID 5314490
tert-butyl-ethoxy-dimethylsilane;4-(2,2-dimethyl-6-methylidenecyclohexyl)-2-methylbutan-2-ol;ethane (PubChem CID 5314490) has the molecular formula C24H52O2Si and a molecular weight of 400.76 g/mol. Its IUPAC name is tert-butyl-ethoxy-dimethylsilane;4-(2,2-dimethyl-6-methylidenecyclohexyl)-2-methylbutan-2-ol;ethane.
| Compound Name | tert-butyl-ethoxy-dimethylsilane;4-(2,2-dimethyl-6-methylidenecyclohexyl)-2-methylbutan-2-ol;ethane |
|---|---|
| PubChem CID | 5314490 |
| Molecular Formula | C24H52O2Si |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | tert-butyl-ethoxy-dimethylsilane;4-(2,2-dimethyl-6-methylidenecyclohexyl)-2-methylbutan-2-ol;ethane |
| SMILES | C=C1CCCC(C)(C)C1CCC(C)(C)O.CC.CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O.C8H20OSi.C2H6/c1-11-7-6-9-13(2,3)12(11)8-10-14(4,5)15;1-7-9-10(5,6)8(2,3)4;1-2/h12,15H,1,6-10H2,2-5H3;7H2,1-6H3;1-2H3 |
| InChIKey | UKNHNVMMYNEWEM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|