C25H31N3O2 — CID 53147714
2-benzyl-3-oxo-N-(3-piperidin-1-ylpropyl)-1,4-dihydroisoquinoline-1-carboxamide (PubChem CID 53147714) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-benzyl-3-oxo-N-(3-piperidin-1-ylpropyl)-1,4-dihydroisoquinoline-1-carboxamide.
| Compound Name | 2-benzyl-3-oxo-N-(3-piperidin-1-ylpropyl)-1,4-dihydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 53147714 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-benzyl-3-oxo-N-(3-piperidin-1-ylpropyl)-1,4-dihydroisoquinoline-1-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)C1c2ccccc2CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H31N3O2/c29-23-18-21-12-5-6-13-22(21)24(28(23)19-20-10-3-1-4-11-20)25(30)26-14-9-17-27-15-7-2-8-16-27/h1,3-6,10-13,24H,2,7-9,14-19H2,(H,26,30) |
| InChIKey | NWEOJHAURXAIDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|