C19H27N3OS — CID 169004751
(4R)-2-benzyl-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1,3-thiazole-4-carboxamide (PubChem CID 169004751) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is (4R)-2-benzyl-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-2-benzyl-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 169004751 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (4R)-2-benzyl-N-(3-piperidin-1-ylpropyl)-4,5-dihydro-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)[C@@H]1CSC(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C19H27N3OS/c23-19(20-10-7-13-22-11-5-2-6-12-22)17-15-24-18(21-17)14-16-8-3-1-4-9-16/h1,3-4,8-9,17H,2,5-7,10-15H2,(H,20,23)/t17-/m0/s1 |
| InChIKey | XCDVMPAIKZVJQN-KRWDZBQOSA-N |
| XLogP | 2.74 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|