C14H12O4 — CID 5314839
2-methoxy-5-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 5314839) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-methoxy-5-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methoxy-5-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5314839 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-methoxy-5-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(c2ccc(OC)cc2)=CC1=O |
| InChI | InChI=1S/C14H12O4/c1-17-10-5-3-9(4-6-10)11-7-13(16)14(18-2)8-12(11)15/h3-8H,1-2H3 |
| InChIKey | BFTXHSZUYPLJBI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|