C24H28FNO2 — CID 53150647
[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-(1-phenylcyclopropyl)methanone (PubChem CID 53150647) has the molecular formula C24H28FNO2 and a molecular weight of 381.49 g/mol. Its IUPAC name is [4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-(1-phenylcyclopropyl)methanone.
| Compound Name | [4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-(1-phenylcyclopropyl)methanone |
|---|---|
| PubChem CID | 53150647 |
| Molecular Formula | C24H28FNO2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | [4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-(1-phenylcyclopropyl)methanone |
| SMILES | O=C(N1CCC(CCOCc2cccc(F)c2)CC1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28FNO2/c25-22-8-4-5-20(17-22)18-28-16-11-19-9-14-26(15-10-19)23(27)24(12-13-24)21-6-2-1-3-7-21/h1-8,17,19H,9-16,18H2 |
| InChIKey | SBCFTPPVXODQLB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|