C21H22F3NO2 — CID 53150604
(2,5-difluorophenyl)-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]methanone (PubChem CID 53150604) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 53150604 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2,5-difluorophenyl)-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1F)N1CCC(CCOCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H22F3NO2/c22-17-3-1-16(2-4-17)14-27-12-9-15-7-10-25(11-8-15)21(26)19-13-18(23)5-6-20(19)24/h1-6,13,15H,7-12,14H2 |
| InChIKey | FJDAXQVDRJQHKN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|