C18H18ClNO5 — CID 53152485
7-chloro-4-(3,4,5-trimethoxyphenyl)-5H-1,4-benzoxazepin-3-one (PubChem CID 53152485) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 7-chloro-4-(3,4,5-trimethoxyphenyl)-5H-1,4-benzoxazepin-3-one.
| Compound Name | 7-chloro-4-(3,4,5-trimethoxyphenyl)-5H-1,4-benzoxazepin-3-one |
|---|---|
| PubChem CID | 53152485 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 7-chloro-4-(3,4,5-trimethoxyphenyl)-5H-1,4-benzoxazepin-3-one |
| SMILES | COc1cc(N2Cc3cc(Cl)ccc3OCC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H18ClNO5/c1-22-15-7-13(8-16(23-2)18(15)24-3)20-9-11-6-12(19)4-5-14(11)25-10-17(20)21/h4-8H,9-10H2,1-3H3 |
| InChIKey | YKVNZFIRDCFPBZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |