C16H14ClNO3 — CID 53152730
7-chloro-4-(2-methoxyphenyl)-5H-1,4-benzoxazepin-3-one (PubChem CID 53152730) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 7-chloro-4-(2-methoxyphenyl)-5H-1,4-benzoxazepin-3-one.
| Compound Name | 7-chloro-4-(2-methoxyphenyl)-5H-1,4-benzoxazepin-3-one |
|---|---|
| PubChem CID | 53152730 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 7-chloro-4-(2-methoxyphenyl)-5H-1,4-benzoxazepin-3-one |
| SMILES | COc1ccccc1N1Cc2cc(Cl)ccc2OCC1=O |
| InChI | InChI=1S/C16H14ClNO3/c1-20-15-5-3-2-4-13(15)18-9-11-8-12(17)6-7-14(11)21-10-16(18)19/h2-8H,9-10H2,1H3 |
| InChIKey | MIDSIOZWBOATHG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |