C22H29N5O3S — CID 53154912
1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[(4-piperidin-1-ylphenyl)methyl]pyrrole-3-sulfonamide (PubChem CID 53154912) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[(4-piperidin-1-ylphenyl)methyl]pyrrole-3-sulfonamide.
| Compound Name | 1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[(4-piperidin-1-ylphenyl)methyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 53154912 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[(4-piperidin-1-ylphenyl)methyl]pyrrole-3-sulfonamide |
| SMILES | Cc1nnc(-c2c(S(=O)(=O)NCc3ccc(N4CCCCC4)cc3)c(C)n(C)c2C)o1 |
| InChI | InChI=1S/C22H29N5O3S/c1-15-20(22-25-24-17(3)30-22)21(16(2)26(15)4)31(28,29)23-14-18-8-10-19(11-9-18)27-12-6-5-7-13-27/h8-11,23H,5-7,12-14H2,1-4H3 |
| InChIKey | QNWASHUWMKTHQH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|