C19H13FN4O3 — CID 53157827
N-(4-cyanophenyl)-1-(3-fluorophenyl)-6-methoxy-4-oxopyridazine-3-carboxamide (PubChem CID 53157827) has the molecular formula C19H13FN4O3 and a molecular weight of 364.34 g/mol. Its IUPAC name is N-(4-cyanophenyl)-1-(3-fluorophenyl)-6-methoxy-4-oxopyridazine-3-carboxamide.
| Compound Name | N-(4-cyanophenyl)-1-(3-fluorophenyl)-6-methoxy-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 53157827 |
| Molecular Formula | C19H13FN4O3 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(4-cyanophenyl)-1-(3-fluorophenyl)-6-methoxy-4-oxopyridazine-3-carboxamide |
| SMILES | COc1cc(=O)c(C(=O)Nc2ccc(C#N)cc2)nn1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H13FN4O3/c1-27-17-10-16(25)18(23-24(17)15-4-2-3-13(20)9-15)19(26)22-14-7-5-12(11-21)6-8-14/h2-10H,1H3,(H,22,26) |
| InChIKey | QMXIRYVEINHYPY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |