C21H26N4O2S — CID 53158433
N-cyclopentyl-4-[4-(4-methylphenyl)piperazine-1-carbonyl]-1,3-thiazole-2-carboxamide (PubChem CID 53158433) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-(4-methylphenyl)piperazine-1-carbonyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-cyclopentyl-4-[4-(4-methylphenyl)piperazine-1-carbonyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 53158433 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-cyclopentyl-4-[4-(4-methylphenyl)piperazine-1-carbonyl]-1,3-thiazole-2-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)c3csc(C(=O)NC4CCCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-15-6-8-17(9-7-15)24-10-12-25(13-11-24)21(27)18-14-28-20(23-18)19(26)22-16-4-2-3-5-16/h6-9,14,16H,2-5,10-13H2,1H3,(H,22,26) |
| InChIKey | OKFHMKUUESPACN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|