C17H15FN2O2 — CID 53160037
1-(4-fluorobenzoyl)-N-methyl-2,3-dihydroindole-4-carboxamide (PubChem CID 53160037) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-methyl-2,3-dihydroindole-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-methyl-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 53160037 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-methyl-2,3-dihydroindole-4-carboxamide |
| SMILES | CNC(=O)c1cccc2c1CCN2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O2/c1-19-16(21)14-3-2-4-15-13(14)9-10-20(15)17(22)11-5-7-12(18)8-6-11/h2-8H,9-10H2,1H3,(H,19,21) |
| InChIKey | LTNFDDJVIPAEBQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |