C21H21FN2O2 — CID 53160038
N-cyclopentyl-1-(4-fluorobenzoyl)-2,3-dihydroindole-4-carboxamide (PubChem CID 53160038) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-cyclopentyl-1-(4-fluorobenzoyl)-2,3-dihydroindole-4-carboxamide.
| Compound Name | N-cyclopentyl-1-(4-fluorobenzoyl)-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 53160038 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-cyclopentyl-1-(4-fluorobenzoyl)-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cccc2c1CCN2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O2/c22-15-10-8-14(9-11-15)21(26)24-13-12-17-18(6-3-7-19(17)24)20(25)23-16-4-1-2-5-16/h3,6-11,16H,1-2,4-5,12-13H2,(H,23,25) |
| InChIKey | FWUCCUNLOQJBBP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |