C19H18N4O3S — CID 53165227
N-(1,3-benzodioxol-5-yl)-2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide (PubChem CID 53165227) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 53165227 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)N1CCCn2nc(-c3cccs3)cc2C1 |
| InChI | InChI=1S/C19H18N4O3S/c24-19(20-13-4-5-16-17(9-13)26-12-25-16)22-6-2-7-23-14(11-22)10-15(21-23)18-3-1-8-27-18/h1,3-5,8-10H,2,6-7,11-12H2,(H,20,24) |
| InChIKey | JQWPNUIFCOQKCS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |