C18H18N4O3S2 — CID 53165231
methyl 3-[(2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 53165231) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is methyl 3-[(2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 53165231 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | methyl 3-[(2-thiophen-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)N1CCCn2nc(-c3cccs3)cc2C1 |
| InChI | InChI=1S/C18H18N4O3S2/c1-25-17(23)16-13(5-9-27-16)19-18(24)21-6-3-7-22-12(11-21)10-14(20-22)15-4-2-8-26-15/h2,4-5,8-10H,3,6-7,11H2,1H3,(H,19,24) |
| InChIKey | UWLUWXQOXFRGDG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |