C4H5N3O4 — CID 5316927
(2,5-dioxoimidazolidin-4-yl)carbamic acid (PubChem CID 5316927) has the molecular formula C4H5N3O4 and a molecular weight of 159.10 g/mol. Its IUPAC name is (2,5-dioxoimidazolidin-4-yl)carbamic acid.
| Compound Name | (2,5-dioxoimidazolidin-4-yl)carbamic acid |
|---|---|
| PubChem CID | 5316927 |
| Molecular Formula | C4H5N3O4 |
| Molecular Weight | 159.10 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | (2,5-dioxoimidazolidin-4-yl)carbamic acid |
| SMILES | O=C(O)NC1NC(=O)NC1=O |
| InChI | InChI=1S/C4H5N3O4/c8-2-1(6-4(10)11)5-3(9)7-2/h1,6H,(H,10,11)(H2,5,7,8,9) |
| InChIKey | ZVPZUQFSFYTXRC-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.10 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|