C16H17N5O3 — CID 53181163
9-[1-(furan-3-carbonyl)piperidin-4-yl]-7-methylpurin-8-one (PubChem CID 53181163) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 9-[1-(furan-3-carbonyl)piperidin-4-yl]-7-methylpurin-8-one.
| Compound Name | 9-[1-(furan-3-carbonyl)piperidin-4-yl]-7-methylpurin-8-one |
|---|---|
| PubChem CID | 53181163 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 9-[1-(furan-3-carbonyl)piperidin-4-yl]-7-methylpurin-8-one |
| SMILES | Cn1c(=O)n(C2CCN(C(=O)c3ccoc3)CC2)c2ncncc21 |
| InChI | InChI=1S/C16H17N5O3/c1-19-13-8-17-10-18-14(13)21(16(19)23)12-2-5-20(6-3-12)15(22)11-4-7-24-9-11/h4,7-10,12H,2-3,5-6H2,1H3 |
| InChIKey | RPDNNBISODYPJS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |