C18H19N5O2 — CID 53184013
N-(3-ethylphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide (PubChem CID 53184013) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(3-ethylphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide.
| Compound Name | N-(3-ethylphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide |
|---|---|
| PubChem CID | 53184013 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(3-ethylphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide |
| SMILES | CCc1cccc(NC(=O)N2CCc3nc4cc[nH]n4c(=O)c3C2)c1 |
| InChI | InChI=1S/C18H19N5O2/c1-2-12-4-3-5-13(10-12)20-18(25)22-9-7-15-14(11-22)17(24)23-16(21-15)6-8-19-23/h3-6,8,10,19H,2,7,9,11H2,1H3,(H,20,25) |
| InChIKey | NNWRQXNGLAQQIK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |