C19H15ClN4O3S2 — CID 53184118
5-(2-chlorophenyl)-11-thiophen-2-ylsulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53184118) has the molecular formula C19H15ClN4O3S2 and a molecular weight of 446.94 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-11-thiophen-2-ylsulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-(2-chlorophenyl)-11-thiophen-2-ylsulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53184118 |
| Molecular Formula | C19H15ClN4O3S2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 5-(2-chlorophenyl)-11-thiophen-2-ylsulfonyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc(-c4ccccc4Cl)[nH]n13)CCN(S(=O)(=O)c1cccs1)C2 |
| InChI | InChI=1S/C19H15ClN4O3S2/c20-14-5-2-1-4-12(14)16-10-17-21-15-7-8-23(11-13(15)19(25)24(17)22-16)29(26,27)18-6-3-9-28-18/h1-6,9-10,22H,7-8,11H2 |
| InChIKey | RPTQKTOSEZBOLD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |