C21H22N2O2 — CID 53184790
N-[(1R,4R,6S)-2-(2-methylbenzoyl)-2-azabicyclo[2.2.1]heptan-6-yl]benzamide (PubChem CID 53184790) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(1R,4R,6S)-2-(2-methylbenzoyl)-2-azabicyclo[2.2.1]heptan-6-yl]benzamide.
| Compound Name | N-[(1R,4R,6S)-2-(2-methylbenzoyl)-2-azabicyclo[2.2.1]heptan-6-yl]benzamide |
|---|---|
| PubChem CID | 53184790 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-[(1R,4R,6S)-2-(2-methylbenzoyl)-2-azabicyclo[2.2.1]heptan-6-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)N1C[C@@H]2C[C@H](NC(=O)c3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C21H22N2O2/c1-14-7-5-6-10-17(14)21(25)23-13-15-11-18(19(23)12-15)22-20(24)16-8-3-2-4-9-16/h2-10,15,18-19H,11-13H2,1H3,(H,22,24)/t15-,18+,19-/m1/s1 |
| InChIKey | LRGNHZVEBIDEOU-AYOQOUSVSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |