C22H24N2O4 — CID 53184800
N-[(1S,4S,5S)-2-(2,4-dimethoxybenzoyl)-2-azabicyclo[2.2.1]heptan-5-yl]benzamide (PubChem CID 53184800) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[(1S,4S,5S)-2-(2,4-dimethoxybenzoyl)-2-azabicyclo[2.2.1]heptan-5-yl]benzamide.
| Compound Name | N-[(1S,4S,5S)-2-(2,4-dimethoxybenzoyl)-2-azabicyclo[2.2.1]heptan-5-yl]benzamide |
|---|---|
| PubChem CID | 53184800 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(1S,4S,5S)-2-(2,4-dimethoxybenzoyl)-2-azabicyclo[2.2.1]heptan-5-yl]benzamide |
| SMILES | COc1ccc(C(=O)N2C[C@@H]3C[C@H]2C[C@@H]3NC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-17-8-9-18(20(12-17)28-2)22(26)24-13-15-10-16(24)11-19(15)23-21(25)14-6-4-3-5-7-14/h3-9,12,15-16,19H,10-11,13H2,1-2H3,(H,23,25)/t15-,16-,19-/m0/s1 |
| InChIKey | MHSHBHLBNUWZLT-BXWFABGCSA-N |
| XLogP | 2.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |