C20H27N3O — CID 53186108
3-[2-(diethylamino)-4-pyridinyl]-N-(2,4-dimethylphenyl)propanamide (PubChem CID 53186108) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[2-(diethylamino)-4-pyridinyl]-N-(2,4-dimethylphenyl)propanamide.
| Compound Name | 3-[2-(diethylamino)-4-pyridinyl]-N-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 53186108 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 3-[2-(diethylamino)-4-pyridinyl]-N-(2,4-dimethylphenyl)propanamide |
| SMILES | CCN(CC)c1cc(CCC(=O)Nc2ccc(C)cc2C)ccn1 |
| InChI | InChI=1S/C20H27N3O/c1-5-23(6-2)19-14-17(11-12-21-19)8-10-20(24)22-18-9-7-15(3)13-16(18)4/h7,9,11-14H,5-6,8,10H2,1-4H3,(H,22,24) |
| InChIKey | FSTPYQUNMNBZCZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |