C24H30N4O2 — CID 53186393
4-[[2-(3,4-dimethoxyphenyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methyl]-N,N-dimethylaniline (PubChem CID 53186393) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53186393 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-c2cc3n(n2)CCCN(Cc2ccc(N(C)C)cc2)C3)cc1OC |
| InChI | InChI=1S/C24H30N4O2/c1-26(2)20-9-6-18(7-10-20)16-27-12-5-13-28-21(17-27)15-22(25-28)19-8-11-23(29-3)24(14-19)30-4/h6-11,14-15H,5,12-13,16-17H2,1-4H3 |
| InChIKey | CAQCZDPEGVGMKO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|