About 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea
1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea (PubChem CID 53188472) has the molecular formula C19H15ClN4O2S
and a molecular weight of 398.88 g/mol. Its IUPAC name is 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea |
| PubChem CID | 53188472 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1nc2c(s1)CN(Cc1ccccc1)C2=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H15ClN4O2S/c20-13-8-4-5-9-14(13)21-18(26)23-19-22-16-15(27-19)11-24(17(16)25)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H2,21,22,23,26) |
| InChIKey | SKGBJXHYYJDSKV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea?
The IUPAC name of 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea (CID 53188472) is 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea.
What is the SMILES notation for 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea?
The canonical SMILES for 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea is O=C(Nc1nc2c(s1)CN(Cc1ccccc1)C2=O)Nc1ccccc1Cl.
What is the InChIKey of 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea?
The InChIKey is SKGBJXHYYJDSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4O2S/c20-13-8-4-5-9-14(13)21-18(26)23-19-22-16-15(27-19)11-24(17(16)25)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H2,21,22,23,26).
What are the key properties of 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea?
1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea has a molecular weight of 398.88 g/mol, XLogP of 4.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-benzyl-4-oxo-6H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(2-chlorophenyl)urea is sourced from PubChem (CID 53188472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).