C19H23N5 — CID 53192701
3-(4-benzyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine (PubChem CID 53192701) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-(4-benzyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine.
| Compound Name | 3-(4-benzyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 53192701 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-(4-benzyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine |
| SMILES | c1ccc(Cn2cnnc2C2CCCN(Cc3ccc[nH]3)C2)cc1 |
| InChI | InChI=1S/C19H23N5/c1-2-6-16(7-3-1)12-24-15-21-22-19(24)17-8-5-11-23(13-17)14-18-9-4-10-20-18/h1-4,6-7,9-10,15,17,20H,5,8,11-14H2 |
| InChIKey | KLKVUYQUICYVRL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |