C23H24N4O2 — CID 53196197
N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethylbenzamide (PubChem CID 53196197) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethylbenzamide.
| Compound Name | N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 53196197 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethylbenzamide |
| SMILES | CCn1c(-c2cc(NC(=O)c3cc(C)cc(C)c3)n[nH]2)cc2ccc(OC)cc21 |
| InChI | InChI=1S/C23H24N4O2/c1-5-27-20-12-18(29-4)7-6-16(20)11-21(27)19-13-22(26-25-19)24-23(28)17-9-14(2)8-15(3)10-17/h6-13H,5H2,1-4H3,(H2,24,25,26,28) |
| InChIKey | CJJUDPLJFACCTB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |