C23H24N4O4 — CID 53195961
N-[5-(1-ethyl-5-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethoxybenzamide (PubChem CID 53195961) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[5-(1-ethyl-5-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[5-(1-ethyl-5-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 53195961 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[5-(1-ethyl-5-methoxyindol-2-yl)-1H-pyrazol-3-yl]-3,5-dimethoxybenzamide |
| SMILES | CCn1c(-c2cc(NC(=O)c3cc(OC)cc(OC)c3)n[nH]2)cc2cc(OC)ccc21 |
| InChI | InChI=1S/C23H24N4O4/c1-5-27-20-7-6-16(29-2)8-14(20)11-21(27)19-13-22(26-25-19)24-23(28)15-9-17(30-3)12-18(10-15)31-4/h6-13H,5H2,1-4H3,(H2,24,25,26,28) |
| InChIKey | IHRILAOBKCLCCL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |