C20H19N5O2 — CID 53196167
N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]pyridine-4-carboxamide (PubChem CID 53196167) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 53196167 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[5-(1-ethyl-6-methoxyindol-2-yl)-1H-pyrazol-3-yl]pyridine-4-carboxamide |
| SMILES | CCn1c(-c2cc(NC(=O)c3ccncc3)n[nH]2)cc2ccc(OC)cc21 |
| InChI | InChI=1S/C20H19N5O2/c1-3-25-17-11-15(27-2)5-4-14(17)10-18(25)16-12-19(24-23-16)22-20(26)13-6-8-21-9-7-13/h4-12H,3H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | RJVZLUKSTZSYEH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |