C26H33N3O4 — CID 53197755
ethyl 4-(3,4-dimethylphenyl)-2-(2-hydroxy-3-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate (PubChem CID 53197755) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethylphenyl)-2-(2-hydroxy-3-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethylphenyl)-2-(2-hydroxy-3-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 53197755 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | ethyl 4-(3,4-dimethylphenyl)-2-(2-hydroxy-3-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)N=C(c1ccc(C)c(C)c1)CC(c1cccc(OC)c1O)N2 |
| InChI | InChI=1S/C26H33N3O4/c1-5-33-25(31)29-13-11-26(12-14-29)27-21(19-10-9-17(2)18(3)15-19)16-22(28-26)20-7-6-8-23(32-4)24(20)30/h6-10,15,22,28,30H,5,11-14,16H2,1-4H3 |
| InChIKey | RJMUHHCYXBVSQI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|