C25H33N3O3 — CID 95113264
2-ethoxy-6-[(2S)-4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol (PubChem CID 95113264) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-ethoxy-6-[(2S)-4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol.
| Compound Name | 2-ethoxy-6-[(2S)-4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 95113264 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 2-ethoxy-6-[(2S)-4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
| SMILES | CCOc1ccc(C2=NC3(CCN(C)CC3)N[C@H](c3cccc(OCC)c3O)C2)cc1 |
| InChI | InChI=1S/C25H33N3O3/c1-4-30-19-11-9-18(10-12-19)21-17-22(20-7-6-8-23(24(20)29)31-5-2)27-25(26-21)13-15-28(3)16-14-25/h6-12,22,27,29H,4-5,13-17H2,1-3H3/t22-/m0/s1 |
| InChIKey | HTTMFWYRQVJISG-QFIPXVFZSA-N |
| XLogP | 4.14 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|