C26H35N3O4 — CID 95113199
2-[(2R)-4-(3,4-dimethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-6-methoxyphenol (PubChem CID 95113199) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 2-[(2R)-4-(3,4-dimethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-6-methoxyphenol.
| Compound Name | 2-[(2R)-4-(3,4-dimethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 95113199 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-[(2R)-4-(3,4-dimethoxyphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-6-methoxyphenol |
| SMILES | COc1ccc(C2=NC3(CCN(C(C)C)CC3)N[C@@H](c3cccc(OC)c3O)C2)cc1OC |
| InChI | InChI=1S/C26H35N3O4/c1-17(2)29-13-11-26(12-14-29)27-20(18-9-10-22(31-3)24(15-18)33-5)16-21(28-26)19-7-6-8-23(32-4)25(19)30/h6-10,15,17,21,28,30H,11-14,16H2,1-5H3/t21-/m1/s1 |
| InChIKey | KAMMXNQOUZOJNM-OAQYLSRUSA-N |
| XLogP | 4.14 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|