C16H17N5O — CID 53201590
5-methyl-7-(2-methylanilino)-2-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one (PubChem CID 53201590) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 5-methyl-7-(2-methylanilino)-2-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one.
| Compound Name | 5-methyl-7-(2-methylanilino)-2-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 53201590 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-methyl-7-(2-methylanilino)-2-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-one |
| SMILES | C=CCn1nc2nc(Nc3ccccc3C)cc(C)n2c1=O |
| InChI | InChI=1S/C16H17N5O/c1-4-9-20-16(22)21-12(3)10-14(18-15(21)19-20)17-13-8-6-5-7-11(13)2/h4-8,10H,1,9H2,2-3H3,(H,17,18,19) |
| InChIKey | KMEQTFAGHHJTPZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|