C16H25NO5 — CID 5320938
(1R,4R,5S,6R,10S,16R)-6-hydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione (PubChem CID 5320938) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is (1R,4R,5S,6R,10S,16R)-6-hydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione.
| Compound Name | (1R,4R,5S,6R,10S,16R)-6-hydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione |
|---|---|
| PubChem CID | 5320938 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (1R,4R,5S,6R,10S,16R)-6-hydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadecane-3,7-dione |
| SMILES | C[C@H]1C(=O)O[C@@H]2CCN3CC[C@H](COC(=O)[C@](C)(O)[C@H]1C)[C@H]23 |
| InChI | InChI=1S/C16H25NO5/c1-9-10(2)16(3,20)15(19)21-8-11-4-6-17-7-5-12(13(11)17)22-14(9)18/h9-13,20H,4-8H2,1-3H3/t9-,10+,11-,12-,13-,16-/m1/s1 |
| InChIKey | GXAPLLMJHZBIPX-TYKAWROJSA-N |
| XLogP | 0.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |