C14H13N5O2S — CID 53210211
11-methyl-N-(4-methyl-1,3-thiazol-2-yl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide (PubChem CID 53210211) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 11-methyl-N-(4-methyl-1,3-thiazol-2-yl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide.
| Compound Name | 11-methyl-N-(4-methyl-1,3-thiazol-2-yl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 53210211 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 11-methyl-N-(4-methyl-1,3-thiazol-2-yl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
| SMILES | Cc1csc(NC(=O)c2c(C)oc3c2C2=NCCN2C=N3)n1 |
| InChI | InChI=1S/C14H13N5O2S/c1-7-5-22-14(17-7)18-12(20)9-8(2)21-13-10(9)11-15-3-4-19(11)6-16-13/h5-6H,3-4H2,1-2H3,(H,17,18,20) |
| InChIKey | FJBRTNIWVOPZHP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |