C14H12FNO3S — CID 53216107
2-(4-fluorophenyl)-2-[(3-methylthiophene-2-carbonyl)amino]acetic acid (PubChem CID 53216107) has the molecular formula C14H12FNO3S and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[(3-methylthiophene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-(4-fluorophenyl)-2-[(3-methylthiophene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 53216107 |
| Molecular Formula | C14H12FNO3S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[(3-methylthiophene-2-carbonyl)amino]acetic acid |
| SMILES | Cc1ccsc1C(=O)NC(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FNO3S/c1-8-6-7-20-12(8)13(17)16-11(14(18)19)9-2-4-10(15)5-3-9/h2-7,11H,1H3,(H,16,17)(H,18,19) |
| InChIKey | LHVLKMHOGKJTHX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |