C12H7F3O3S — CID 53222060
4-[3-hydroxy-5-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid (PubChem CID 53222060) has the molecular formula C12H7F3O3S and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-[3-hydroxy-5-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[3-hydroxy-5-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 53222060 |
| Molecular Formula | C12H7F3O3S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 4-[3-hydroxy-5-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(O)cc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C12H7F3O3S/c13-12(14,15)8-1-6(2-9(16)4-8)7-3-10(11(17)18)19-5-7/h1-5,16H,(H,17,18) |
| InChIKey | VMKFYBTVKGMUKH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |