C25H23F6N3O3S3 — CID 11411019
2-[4-[2-[(5Z)-5-[1-[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]piperazin-1-yl]acetic acid (PubChem CID 11411019) has the molecular formula C25H23F6N3O3S3 and a molecular weight of 623.67 g/mol. Its IUPAC name is 2-[4-[2-[(5Z)-5-[1-[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[(5Z)-5-[1-[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 11411019 |
| Molecular Formula | C25H23F6N3O3S3 |
| Molecular Weight | 623.67 g/mol |
| Exact Mass | 623.08 |
| IUPAC Name | 2-[4-[2-[(5Z)-5-[1-[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]piperazin-1-yl]acetic acid |
| SMILES | C/C(=C1/SC(=S)N(CCN2CCN(CC(=O)O)CC2)C1=O)c1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C25H23F6N3O3S3/c1-14(19-10-16(13-39-19)15-8-17(24(26,27)28)11-18(9-15)25(29,30)31)21-22(37)34(23(38)40-21)7-6-32-2-4-33(5-3-32)12-20(35)36/h8-11,13H,2-7,12H2,1H3,(H,35,36)/b21-14- |
| InChIKey | VERISOSHSNRFQA-STZFKDTASA-N |
| XLogP | 5.75 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|