C26H29N3O4 — CID 5322426
4-[3-(4-benzylpiperazin-1-yl)propanoyl]-9-hydroxy-2,3-dihydro-1H-chromeno[3,4-b]pyridin-5-one (PubChem CID 5322426) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-[3-(4-benzylpiperazin-1-yl)propanoyl]-9-hydroxy-2,3-dihydro-1H-chromeno[3,4-b]pyridin-5-one.
| Compound Name | 4-[3-(4-benzylpiperazin-1-yl)propanoyl]-9-hydroxy-2,3-dihydro-1H-chromeno[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 5322426 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-[3-(4-benzylpiperazin-1-yl)propanoyl]-9-hydroxy-2,3-dihydro-1H-chromeno[3,4-b]pyridin-5-one |
| SMILES | O=C(CCN1CCN(Cc2ccccc2)CC1)N1CCCc2c1c(=O)oc1ccc(O)cc21 |
| InChI | InChI=1S/C26H29N3O4/c30-20-8-9-23-22(17-20)21-7-4-11-29(25(21)26(32)33-23)24(31)10-12-27-13-15-28(16-14-27)18-19-5-2-1-3-6-19/h1-3,5-6,8-9,17,30H,4,7,10-16,18H2 |
| InChIKey | MOUSOYJTLUGPLO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|