C26H36N4O4S — CID 5323021
2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide (PubChem CID 5323021) has the molecular formula C26H36N4O4S and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide.
| Compound Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 5323021 |
| Molecular Formula | C26H36N4O4S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide |
| SMILES | CCN(CCCNC(=O)C(NS(=O)(=O)c1ccc2c(c1)CCN2C(C)=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H36N4O4S/c1-5-29(22-10-7-6-8-11-22)16-9-15-27-26(32)25(19(2)3)28-35(33,34)23-12-13-24-21(18-23)14-17-30(24)20(4)31/h6-8,10-13,18-19,25,28H,5,9,14-17H2,1-4H3,(H,27,32) |
| InChIKey | NUVWQRZVNCWFRP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|