C20H16ClN3O3 — CID 53233876
3-[3-[(6-chloro-3-pyridinyl)methylamino]-2-pyridinyl]-3-oxo-2-phenylpropanoic acid (PubChem CID 53233876) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-[3-[(6-chloro-3-pyridinyl)methylamino]-2-pyridinyl]-3-oxo-2-phenylpropanoic acid.
| Compound Name | 3-[3-[(6-chloro-3-pyridinyl)methylamino]-2-pyridinyl]-3-oxo-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 53233876 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-[3-[(6-chloro-3-pyridinyl)methylamino]-2-pyridinyl]-3-oxo-2-phenylpropanoic acid |
| SMILES | O=C(O)C(C(=O)c1ncccc1NCc1ccc(Cl)nc1)c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O3/c21-16-9-8-13(12-24-16)11-23-15-7-4-10-22-18(15)19(25)17(20(26)27)14-5-2-1-3-6-14/h1-10,12,17,23H,11H2,(H,26,27) |
| InChIKey | UNJOFPOCMSYTLC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|