C24H22Cl2N6O2 — CID 87808166
2-[N-amino-4-[[(2-chloro-3-pyridinyl)amino]methyl]-2-hydroxyanilino]-5-[[(6-chloro-3-pyridinyl)amino]methyl]phenol (PubChem CID 87808166) has the molecular formula C24H22Cl2N6O2 and a molecular weight of 497.39 g/mol. Its IUPAC name is 2-[N-amino-4-[[(2-chloro-3-pyridinyl)amino]methyl]-2-hydroxyanilino]-5-[[(6-chloro-3-pyridinyl)amino]methyl]phenol.
| Compound Name | 2-[N-amino-4-[[(2-chloro-3-pyridinyl)amino]methyl]-2-hydroxyanilino]-5-[[(6-chloro-3-pyridinyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 87808166 |
| Molecular Formula | C24H22Cl2N6O2 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[N-amino-4-[[(2-chloro-3-pyridinyl)amino]methyl]-2-hydroxyanilino]-5-[[(6-chloro-3-pyridinyl)amino]methyl]phenol |
| SMILES | NN(c1ccc(CNc2ccc(Cl)nc2)cc1O)c1ccc(CNc2cccnc2Cl)cc1O |
| InChI | InChI=1S/C24H22Cl2N6O2/c25-23-8-5-17(14-31-23)29-12-15-3-6-19(21(33)10-15)32(27)20-7-4-16(11-22(20)34)13-30-18-2-1-9-28-24(18)26/h1-11,14,29-30,33-34H,12-13,27H2 |
| InChIKey | HVXZDDGSSBXXIE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|