C13H11ClN2O3 — CID 55013206
6-[[(2-chloro-3-pyridinyl)amino]methyl]-1,3-benzodioxol-5-ol (PubChem CID 55013206) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. Its IUPAC name is 6-[[(2-chloro-3-pyridinyl)amino]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[(2-chloro-3-pyridinyl)amino]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 55013206 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 6-[[(2-chloro-3-pyridinyl)amino]methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CNc1cccnc1Cl)OCO2 |
| InChI | InChI=1S/C13H11ClN2O3/c14-13-9(2-1-3-15-13)16-6-8-4-11-12(5-10(8)17)19-7-18-11/h1-5,16-17H,6-7H2 |
| InChIKey | QASDETHZYGHQQR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|