C10H7Br2ClN2O — CID 62086085
2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]pyridin-3-amine (PubChem CID 62086085) has the molecular formula C10H7Br2ClN2O and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]pyridin-3-amine.
| Compound Name | 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 62086085 |
| Molecular Formula | C10H7Br2ClN2O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 363.86 |
| IUPAC Name | 2-chloro-N-[(4,5-dibromofuran-2-yl)methyl]pyridin-3-amine |
| SMILES | Clc1ncccc1NCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C10H7Br2ClN2O/c11-7-4-6(16-9(7)12)5-15-8-2-1-3-14-10(8)13/h1-4,15H,5H2 |
| InChIKey | BUOZNUYQMVPSKY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|