C14H11Cl2NO3 — CID 65467963
6-[(2,6-dichloroanilino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 65467963) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 6-[(2,6-dichloroanilino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(2,6-dichloroanilino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 65467963 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 6-[(2,6-dichloroanilino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CNc1c(Cl)cccc1Cl)OCO2 |
| InChI | InChI=1S/C14H11Cl2NO3/c15-9-2-1-3-10(16)14(9)17-6-8-4-12-13(5-11(8)18)20-7-19-12/h1-5,17-18H,6-7H2 |
| InChIKey | GSBLPYLEHZANAB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|