C22H35N3O3 — CID 53235045
N'-[(3Z,6Z,9Z)-14-(cyclopropylamino)-14-oxotetradeca-3,6,9-trienyl]-N-propyloxamide (PubChem CID 53235045) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is N'-[(3Z,6Z,9Z)-14-(cyclopropylamino)-14-oxotetradeca-3,6,9-trienyl]-N-propyloxamide.
| Compound Name | N'-[(3Z,6Z,9Z)-14-(cyclopropylamino)-14-oxotetradeca-3,6,9-trienyl]-N-propyloxamide |
|---|---|
| PubChem CID | 53235045 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | N'-[(3Z,6Z,9Z)-14-(cyclopropylamino)-14-oxotetradeca-3,6,9-trienyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NCC/C=C\C/C=C\C/C=C\CCCC(=O)NC1CC1 |
| InChI | InChI=1S/C22H35N3O3/c1-2-17-23-21(27)22(28)24-18-13-11-9-7-5-3-4-6-8-10-12-14-20(26)25-19-15-16-19/h3,5-6,8-9,11,19H,2,4,7,10,12-18H2,1H3,(H,23,27)(H,24,28)(H,25,26)/b5-3-,8-6-,11-9- |
| InChIKey | SUAYWSPLUPXSEX-LJFLDRDWSA-N |
| XLogP | 2.92 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|