C31H38FN3O5Si — CID 53236125
3-[(4-fluorophenyl)methyl]-1-[3-(oxan-4-yloxy)prop-1-ynyl]-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one (PubChem CID 53236125) has the molecular formula C31H38FN3O5Si and a molecular weight of 579.75 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-1-[3-(oxan-4-yloxy)prop-1-ynyl]-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-1-[3-(oxan-4-yloxy)prop-1-ynyl]-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 53236125 |
| Molecular Formula | C31H38FN3O5Si |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-1-[3-(oxan-4-yloxy)prop-1-ynyl]-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
| SMILES | C[Si](C)(C)CCOCON1CCc2c(ncc3c2c(C#CCOC2CCOCC2)cn3Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C31H38FN3O5Si/c1-41(2,3)18-17-38-22-40-35-13-10-27-29-24(5-4-14-39-26-11-15-37-16-12-26)21-34(20-23-6-8-25(32)9-7-23)28(29)19-33-30(27)31(35)36/h6-9,19,21,26H,10-18,20,22H2,1-3H3 |
| InChIKey | VIGGYSFCQZTGEO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|