C31H37FN4O4Si — CID 53239075
3-[(4-fluorophenyl)methyl]-1-(2-pyridin-2-ylethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one (PubChem CID 53239075) has the molecular formula C31H37FN4O4Si and a molecular weight of 576.75 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-1-(2-pyridin-2-ylethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-1-(2-pyridin-2-ylethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 53239075 |
| Molecular Formula | C31H37FN4O4Si |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-1-(2-pyridin-2-ylethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
| SMILES | C[Si](C)(C)CCOCON1CCc2c(ncc3c2c(COCCc2ccccn2)cn3Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C31H37FN4O4Si/c1-41(2,3)17-16-39-22-40-36-14-11-27-29-24(21-38-15-12-26-6-4-5-13-33-26)20-35(19-23-7-9-25(32)10-8-23)28(29)18-34-30(27)31(36)37/h4-10,13,18,20H,11-12,14-17,19,21-22H2,1-3H3 |
| InChIKey | AUIUXWQMGSHOAA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|