About 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea
1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea (PubChem CID 53236207) has the molecular formula C17H18N6O
and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea |
| PubChem CID | 53236207 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea |
| SMILES | Cn1cc(-c2cnc3c(NC(=O)NC4CCC4)ccnc3c2)cn1 |
| InChI | InChI=1S/C17H18N6O/c1-23-10-12(9-20-23)11-7-15-16(19-8-11)14(5-6-18-15)22-17(24)21-13-3-2-4-13/h5-10,13H,2-4H2,1H3,(H2,18,21,22,24) |
| InChIKey | YYLIBVSMZZUYKS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea?
The IUPAC name of 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea (CID 53236207) is 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea.
What is the SMILES notation for 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea?
The canonical SMILES for 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea is Cn1cc(-c2cnc3c(NC(=O)NC4CCC4)ccnc3c2)cn1.
What is the InChIKey of 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea?
The InChIKey is YYLIBVSMZZUYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N6O/c1-23-10-12(9-20-23)11-7-15-16(19-8-11)14(5-6-18-15)22-17(24)21-13-3-2-4-13/h5-10,13H,2-4H2,1H3,(H2,18,21,22,24).
What are the key properties of 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea?
1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea has a molecular weight of 322.37 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]urea is sourced from PubChem (CID 53236207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).