C17H20N4O — CID 166368604
1-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-3-quinoxalin-5-ylurea (PubChem CID 166368604) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-3-quinoxalin-5-ylurea.
| Compound Name | 1-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-3-quinoxalin-5-ylurea |
|---|---|
| PubChem CID | 166368604 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-3-quinoxalin-5-ylurea |
| SMILES | O=C(Nc1cccc2nccnc12)NC1CC2CCCC2C1 |
| InChI | InChI=1S/C17H20N4O/c22-17(20-13-9-11-3-1-4-12(11)10-13)21-15-6-2-5-14-16(15)19-8-7-18-14/h2,5-8,11-13H,1,3-4,9-10H2,(H2,20,21,22) |
| InChIKey | FEQFTWSXDXZZQE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |